C12H10Cl2N2O3S2 — CID 43444002
N-(2-amino-4,6-dichlorophenyl)-2-thiophen-2-ylsulfonylacetamide (PubChem CID 43444002) has the molecular formula C12H10Cl2N2O3S2 and a molecular weight of 365.26 g/mol. Its IUPAC name is N-(2-amino-4,6-dichlorophenyl)-2-thiophen-2-ylsulfonylacetamide.
| Compound Name | N-(2-amino-4,6-dichlorophenyl)-2-thiophen-2-ylsulfonylacetamide |
|---|---|
| PubChem CID | 43444002 |
| Molecular Formula | C12H10Cl2N2O3S2 |
| Molecular Weight | 365.26 g/mol |
| Exact Mass | 363.95 |
| IUPAC Name | N-(2-amino-4,6-dichlorophenyl)-2-thiophen-2-ylsulfonylacetamide |
| SMILES | Nc1cc(Cl)cc(Cl)c1NC(=O)CS(=O)(=O)c1cccs1 |
| InChI | InChI=1S/C12H10Cl2N2O3S2/c13-7-4-8(14)12(9(15)5-7)16-10(17)6-21(18,19)11-2-1-3-20-11/h1-5H,6,15H2,(H,16,17) |
| InChIKey | LNCJIELMFTWJAD-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 89.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.26 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|