C14H15NO5S2 — CID 42100169
N-(2,5-dimethoxyphenyl)-2-thiophen-2-ylsulfonylacetamide (PubChem CID 42100169) has the molecular formula C14H15NO5S2 and a molecular weight of 341.41 g/mol. Its IUPAC name is N-(2,5-dimethoxyphenyl)-2-thiophen-2-ylsulfonylacetamide.
| Compound Name | N-(2,5-dimethoxyphenyl)-2-thiophen-2-ylsulfonylacetamide |
|---|---|
| PubChem CID | 42100169 |
| Molecular Formula | C14H15NO5S2 |
| Molecular Weight | 341.41 g/mol |
| Exact Mass | 341.04 |
| IUPAC Name | N-(2,5-dimethoxyphenyl)-2-thiophen-2-ylsulfonylacetamide |
| SMILES | COc1ccc(OC)c(NC(=O)CS(=O)(=O)c2cccs2)c1 |
| InChI | InChI=1S/C14H15NO5S2/c1-19-10-5-6-12(20-2)11(8-10)15-13(16)9-22(17,18)14-4-3-7-21-14/h3-8H,9H2,1-2H3,(H,15,16) |
| InChIKey | KPRCTFORALTAMF-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 81.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.41 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |