C13H15NO5S — CID 82368879
N-(2,5-dimethoxyphenyl)-2-prop-2-ynylsulfonylacetamide (PubChem CID 82368879) has the molecular formula C13H15NO5S and a molecular weight of 297.33 g/mol. Its IUPAC name is N-(2,5-dimethoxyphenyl)-2-prop-2-ynylsulfonylacetamide.
| Compound Name | N-(2,5-dimethoxyphenyl)-2-prop-2-ynylsulfonylacetamide |
|---|---|
| PubChem CID | 82368879 |
| Molecular Formula | C13H15NO5S |
| Molecular Weight | 297.33 g/mol |
| Exact Mass | 297.07 |
| IUPAC Name | N-(2,5-dimethoxyphenyl)-2-prop-2-ynylsulfonylacetamide |
| SMILES | C#CCS(=O)(=O)CC(=O)Nc1cc(OC)ccc1OC |
| InChI | InChI=1S/C13H15NO5S/c1-4-7-20(16,17)9-13(15)14-11-8-10(18-2)5-6-12(11)19-3/h1,5-6,8H,7,9H2,2-3H3,(H,14,15) |
| InChIKey | YUMOGBKXOTWBLY-UHFFFAOYSA-N |
| XLogP | 0.69 |
| TPSA | 81.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.33 |
| LogP ≤ 5 | 0.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|