C25H23N3O9S4 — CID 25037277
[2-(2,5-dimethoxyanilino)-2-oxoethyl] 3,5-bis(thiophen-2-ylsulfonylamino)benzoate (PubChem CID 25037277) has the molecular formula C25H23N3O9S4 and a molecular weight of 637.74 g/mol. Its IUPAC name is [2-(2,5-dimethoxyanilino)-2-oxoethyl] 3,5-bis(thiophen-2-ylsulfonylamino)benzoate.
| Compound Name | [2-(2,5-dimethoxyanilino)-2-oxoethyl] 3,5-bis(thiophen-2-ylsulfonylamino)benzoate |
|---|---|
| PubChem CID | 25037277 |
| Molecular Formula | C25H23N3O9S4 |
| Molecular Weight | 637.74 g/mol |
| Exact Mass | 637.03 |
| IUPAC Name | [2-(2,5-dimethoxyanilino)-2-oxoethyl] 3,5-bis(thiophen-2-ylsulfonylamino)benzoate |
| SMILES | COc1ccc(OC)c(NC(=O)COC(=O)c2cc(NS(=O)(=O)c3cccs3)cc(NS(=O)(=O)c3cccs3)c2)c1 |
| InChI | InChI=1S/C25H23N3O9S4/c1-35-19-7-8-21(36-2)20(14-19)26-22(29)15-37-25(30)16-11-17(27-40(31,32)23-5-3-9-38-23)13-18(12-16)28-41(33,34)24-6-4-10-39-24/h3-14,27-28H,15H2,1-2H3,(H,26,29) |
| InChIKey | GRUSOXFDNCEINW-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 166.20 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 637.74 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 11 |