C14H13Cl2N3O2 — CID 62881177
N-(2-amino-4,6-dichlorophenyl)-3-(4-oxo-1-pyridinyl)propanamide (PubChem CID 62881177) has the molecular formula C14H13Cl2N3O2 and a molecular weight of 326.18 g/mol. Its IUPAC name is N-(2-amino-4,6-dichlorophenyl)-3-(4-oxo-1-pyridinyl)propanamide.
| Compound Name | N-(2-amino-4,6-dichlorophenyl)-3-(4-oxo-1-pyridinyl)propanamide |
|---|---|
| PubChem CID | 62881177 |
| Molecular Formula | C14H13Cl2N3O2 |
| Molecular Weight | 326.18 g/mol |
| Exact Mass | 325.04 |
| IUPAC Name | N-(2-amino-4,6-dichlorophenyl)-3-(4-oxo-1-pyridinyl)propanamide |
| SMILES | Nc1cc(Cl)cc(Cl)c1NC(=O)CCn1ccc(=O)cc1 |
| InChI | InChI=1S/C14H13Cl2N3O2/c15-9-7-11(16)14(12(17)8-9)18-13(21)3-6-19-4-1-10(20)2-5-19/h1-2,4-5,7-8H,3,6,17H2,(H,18,21) |
| InChIKey | QECZLTBPVXKRDI-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 77.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.18 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|