C12H12N2O3S2 — CID 43443995
N-(4-aminophenyl)-2-thiophen-2-ylsulfonylacetamide (PubChem CID 43443995) has the molecular formula C12H12N2O3S2 and a molecular weight of 296.37 g/mol. Its IUPAC name is N-(4-aminophenyl)-2-thiophen-2-ylsulfonylacetamide.
| Compound Name | N-(4-aminophenyl)-2-thiophen-2-ylsulfonylacetamide |
|---|---|
| PubChem CID | 43443995 |
| Molecular Formula | C12H12N2O3S2 |
| Molecular Weight | 296.37 g/mol |
| Exact Mass | 296.03 |
| IUPAC Name | N-(4-aminophenyl)-2-thiophen-2-ylsulfonylacetamide |
| SMILES | Nc1ccc(NC(=O)CS(=O)(=O)c2cccs2)cc1 |
| InChI | InChI=1S/C12H12N2O3S2/c13-9-3-5-10(6-4-9)14-11(15)8-19(16,17)12-2-1-7-18-12/h1-7H,8,13H2,(H,14,15) |
| InChIKey | CJNBHQFATIOYIH-UHFFFAOYSA-N |
| XLogP | 1.74 |
| TPSA | 89.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.37 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|