C20H20ClN3O2S — CID 155744561
2-chloro-6-(1,2,3,5,6,7-hexahydro-s-indacen-4-ylcarbamoylamino)sulfanylbenzamide (PubChem CID 155744561) has the molecular formula C20H20ClN3O2S and a molecular weight of 401.92 g/mol. Its IUPAC name is 2-chloro-6-(1,2,3,5,6,7-hexahydro-s-indacen-4-ylcarbamoylamino)sulfanylbenzamide.
| Compound Name | 2-chloro-6-(1,2,3,5,6,7-hexahydro-s-indacen-4-ylcarbamoylamino)sulfanylbenzamide |
|---|---|
| PubChem CID | 155744561 |
| Molecular Formula | C20H20ClN3O2S |
| Molecular Weight | 401.92 g/mol |
| Exact Mass | 401.10 |
| IUPAC Name | 2-chloro-6-(1,2,3,5,6,7-hexahydro-s-indacen-4-ylcarbamoylamino)sulfanylbenzamide |
| SMILES | NC(=O)c1c(Cl)cccc1SNC(=O)Nc1c2c(cc3c1CCC3)CCC2 |
| InChI | InChI=1S/C20H20ClN3O2S/c21-15-8-3-9-16(17(15)19(22)25)27-24-20(26)23-18-13-6-1-4-11(13)10-12-5-2-7-14(12)18/h3,8-10H,1-2,4-7H2,(H2,22,25)(H2,23,24,26) |
| InChIKey | UDKUPJPYTXJLAS-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 84.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.92 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|