C18H18FN3O2S2 — CID 155744604
3-[(8-fluoro-1,2,3,5,6,7-hexahydro-s-indacen-4-yl)carbamoylamino]sulfanylthiophene-2-carboxamide (PubChem CID 155744604) has the molecular formula C18H18FN3O2S2 and a molecular weight of 391.49 g/mol. Its IUPAC name is 3-[(8-fluoro-1,2,3,5,6,7-hexahydro-s-indacen-4-yl)carbamoylamino]sulfanylthiophene-2-carboxamide.
| Compound Name | 3-[(8-fluoro-1,2,3,5,6,7-hexahydro-s-indacen-4-yl)carbamoylamino]sulfanylthiophene-2-carboxamide |
|---|---|
| PubChem CID | 155744604 |
| Molecular Formula | C18H18FN3O2S2 |
| Molecular Weight | 391.49 g/mol |
| Exact Mass | 391.08 |
| IUPAC Name | 3-[(8-fluoro-1,2,3,5,6,7-hexahydro-s-indacen-4-yl)carbamoylamino]sulfanylthiophene-2-carboxamide |
| SMILES | NC(=O)c1sccc1SNC(=O)Nc1c2c(c(F)c3c1CCC3)CCC2 |
| InChI | InChI=1S/C18H18FN3O2S2/c19-14-9-3-1-5-11(9)15(12-6-2-4-10(12)14)21-18(24)22-26-13-7-8-25-16(13)17(20)23/h7-8H,1-6H2,(H2,20,23)(H2,21,22,24) |
| InChIKey | VXUZONYIVSWFPH-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 84.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.49 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|