C19H20FN3O3S2 — CID 146611286
1-[amino-(3,4-dihydro-2H-thieno[3,4-b]pyran-7-yl)-oxo-λ6-sulfanylidene]-3-(7-fluoro-2-tricyclo[6.3.0.03,6]undeca-1(8),2,6-trienyl)urea (PubChem CID 146611286) has the molecular formula C19H20FN3O3S2 and a molecular weight of 421.52 g/mol. Its IUPAC name is 1-[amino-(3,4-dihydro-2H-thieno[3,4-b]pyran-7-yl)-oxo-λ6-sulfanylidene]-3-(7-fluoro-2-tricyclo[6.3.0.03,6]undeca-1(8),2,6-trienyl)urea.
| Compound Name | 1-[amino-(3,4-dihydro-2H-thieno[3,4-b]pyran-7-yl)-oxo-λ6-sulfanylidene]-3-(7-fluoro-2-tricyclo[6.3.0.03,6]undeca-1(8),2,6-trienyl)urea |
|---|---|
| PubChem CID | 146611286 |
| Molecular Formula | C19H20FN3O3S2 |
| Molecular Weight | 421.52 g/mol |
| Exact Mass | 421.09 |
| IUPAC Name | 1-[amino-(3,4-dihydro-2H-thieno[3,4-b]pyran-7-yl)-oxo-λ6-sulfanylidene]-3-(7-fluoro-2-tricyclo[6.3.0.03,6]undeca-1(8),2,6-trienyl)urea |
| SMILES | NS(=O)(=NC(=O)Nc1c2c(c(F)c3c1CC3)CCC2)c1scc2c1OCCC2 |
| InChI | InChI=1S/C19H20FN3O3S2/c20-15-11-4-1-5-13(11)16(14-7-6-12(14)15)22-19(24)23-28(21,25)18-17-10(9-27-18)3-2-8-26-17/h9H,1-8H2,(H3,21,22,23,24,25) |
| InChIKey | RCKDMUXHXGXABM-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 93.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.52 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |