C21H23ClFN3O4S — CID 146603344
1-[amino-[2-chloro-4-(1,1-dihydroxyethyl)phenyl]-oxo-λ6-sulfanylidene]-3-(8-fluoro-1,2,3,5,6,7-hexahydro-s-indacen-4-yl)urea (PubChem CID 146603344) has the molecular formula C21H23ClFN3O4S and a molecular weight of 467.95 g/mol. Its IUPAC name is 1-[amino-[2-chloro-4-(1,1-dihydroxyethyl)phenyl]-oxo-λ6-sulfanylidene]-3-(8-fluoro-1,2,3,5,6,7-hexahydro-s-indacen-4-yl)urea.
| Compound Name | 1-[amino-[2-chloro-4-(1,1-dihydroxyethyl)phenyl]-oxo-λ6-sulfanylidene]-3-(8-fluoro-1,2,3,5,6,7-hexahydro-s-indacen-4-yl)urea |
|---|---|
| PubChem CID | 146603344 |
| Molecular Formula | C21H23ClFN3O4S |
| Molecular Weight | 467.95 g/mol |
| Exact Mass | 467.11 |
| IUPAC Name | 1-[amino-[2-chloro-4-(1,1-dihydroxyethyl)phenyl]-oxo-λ6-sulfanylidene]-3-(8-fluoro-1,2,3,5,6,7-hexahydro-s-indacen-4-yl)urea |
| SMILES | CC(O)(O)c1ccc(S(N)(=O)=NC(=O)Nc2c3c(c(F)c4c2CCC4)CCC3)c(Cl)c1 |
| InChI | InChI=1S/C21H23ClFN3O4S/c1-21(28,29)11-8-9-17(16(22)10-11)31(24,30)26-20(27)25-19-14-6-2-4-12(14)18(23)13-5-3-7-15(13)19/h8-10,28-29H,2-7H2,1H3,(H3,24,25,26,27,30) |
| InChIKey | PFKIRKMPAFKRSK-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 125.01 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.95 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|