C19H21F2N5O3S — CID 175814452
1-[amino-(2-methyl-2,3-dihydropyrazolo[5,1-b][1,3]oxazol-7-yl)-oxo-λ6-sulfanylidene]-3-[(2R)-2,8-difluoro-1,2,3,5,6,7-hexahydro-s-indacen-4-yl]urea (PubChem CID 175814452) has the molecular formula C19H21F2N5O3S and a molecular weight of 437.47 g/mol. Its IUPAC name is 1-[amino-(2-methyl-2,3-dihydropyrazolo[5,1-b][1,3]oxazol-7-yl)-oxo-λ6-sulfanylidene]-3-[(2R)-2,8-difluoro-1,2,3,5,6,7-hexahydro-s-indacen-4-yl]urea.
| Compound Name | 1-[amino-(2-methyl-2,3-dihydropyrazolo[5,1-b][1,3]oxazol-7-yl)-oxo-λ6-sulfanylidene]-3-[(2R)-2,8-difluoro-1,2,3,5,6,7-hexahydro-s-indacen-4-yl]urea |
|---|---|
| PubChem CID | 175814452 |
| Molecular Formula | C19H21F2N5O3S |
| Molecular Weight | 437.47 g/mol |
| Exact Mass | 437.13 |
| IUPAC Name | 1-[amino-(2-methyl-2,3-dihydropyrazolo[5,1-b][1,3]oxazol-7-yl)-oxo-λ6-sulfanylidene]-3-[(2R)-2,8-difluoro-1,2,3,5,6,7-hexahydro-s-indacen-4-yl]urea |
| SMILES | CC1Cn2ncc(S(N)(=O)=NC(=O)Nc3c4c(c(F)c5c3C[C@@H](F)C5)CCC4)c2O1 |
| InChI | InChI=1S/C19H21F2N5O3S/c1-9-8-26-18(29-9)15(7-23-26)30(22,28)25-19(27)24-17-12-4-2-3-11(12)16(21)13-5-10(20)6-14(13)17/h7,9-10H,2-6,8H2,1H3,(H3,22,24,25,27,28)/t9?,10-,30?/m0/s1 |
| InChIKey | DALBKGSHKPXKFR-SILZHWMVSA-N |
| XLogP | 2.66 |
| TPSA | 111.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.47 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |