C20H24FN5O3S — CID 165369905
1-[amino-(6,7-dihydro-5H-pyrazolo[5,1-b][1,3]oxazin-3-yl)-oxo-λ6-sulfanylidene]-3-[(2R,5R)-2-fluoro-5-methyl-1,2,3,5,6,7-hexahydro-s-indacen-4-yl]urea (PubChem CID 165369905) has the molecular formula C20H24FN5O3S and a molecular weight of 433.51 g/mol. Its IUPAC name is 1-[amino-(6,7-dihydro-5H-pyrazolo[5,1-b][1,3]oxazin-3-yl)-oxo-λ6-sulfanylidene]-3-[(2R,5R)-2-fluoro-5-methyl-1,2,3,5,6,7-hexahydro-s-indacen-4-yl]urea.
| Compound Name | 1-[amino-(6,7-dihydro-5H-pyrazolo[5,1-b][1,3]oxazin-3-yl)-oxo-λ6-sulfanylidene]-3-[(2R,5R)-2-fluoro-5-methyl-1,2,3,5,6,7-hexahydro-s-indacen-4-yl]urea |
|---|---|
| PubChem CID | 165369905 |
| Molecular Formula | C20H24FN5O3S |
| Molecular Weight | 433.51 g/mol |
| Exact Mass | 433.16 |
| IUPAC Name | 1-[amino-(6,7-dihydro-5H-pyrazolo[5,1-b][1,3]oxazin-3-yl)-oxo-λ6-sulfanylidene]-3-[(2R,5R)-2-fluoro-5-methyl-1,2,3,5,6,7-hexahydro-s-indacen-4-yl]urea |
| SMILES | C[C@@H]1CCc2cc3c(c(NC(=O)N=S(N)(=O)c4cnn5c4OCCC5)c21)C[C@H](F)C3 |
| InChI | InChI=1S/C20H24FN5O3S/c1-11-3-4-12-7-13-8-14(21)9-15(13)18(17(11)12)24-20(27)25-30(22,28)16-10-23-26-5-2-6-29-19(16)26/h7,10-11,14H,2-6,8-9H2,1H3,(H3,22,24,25,27,28)/t11-,14-,30?/m1/s1 |
| InChIKey | UDVCFTLHUAYGRQ-BOVWHBRTSA-N |
| XLogP | 3.08 |
| TPSA | 111.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.51 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |