C18H22N6O3S — CID 146618549
1-[amino-(6,7-dihydro-5H-pyrazolo[5,1-b][1,3]oxazin-3-yl)-oxo-λ6-sulfanylidene]-3-(7-azatricyclo[7.3.0.02,6]dodeca-1,6,8-trien-8-yl)urea (PubChem CID 146618549) has the molecular formula C18H22N6O3S and a molecular weight of 402.48 g/mol. Its IUPAC name is 1-[amino-(6,7-dihydro-5H-pyrazolo[5,1-b][1,3]oxazin-3-yl)-oxo-λ6-sulfanylidene]-3-(7-azatricyclo[7.3.0.02,6]dodeca-1,6,8-trien-8-yl)urea.
| Compound Name | 1-[amino-(6,7-dihydro-5H-pyrazolo[5,1-b][1,3]oxazin-3-yl)-oxo-λ6-sulfanylidene]-3-(7-azatricyclo[7.3.0.02,6]dodeca-1,6,8-trien-8-yl)urea |
|---|---|
| PubChem CID | 146618549 |
| Molecular Formula | C18H22N6O3S |
| Molecular Weight | 402.48 g/mol |
| Exact Mass | 402.15 |
| IUPAC Name | 1-[amino-(6,7-dihydro-5H-pyrazolo[5,1-b][1,3]oxazin-3-yl)-oxo-λ6-sulfanylidene]-3-(7-azatricyclo[7.3.0.02,6]dodeca-1,6,8-trien-8-yl)urea |
| SMILES | NS(=O)(=NC(=O)Nc1nc2c(c3c1CCC3)CCC2)c1cnn2c1OCCC2 |
| InChI | InChI=1S/C18H22N6O3S/c19-28(26,15-10-20-24-8-3-9-27-17(15)24)23-18(25)22-16-13-6-1-4-11(13)12-5-2-7-14(12)21-16/h10H,1-9H2,(H3,19,21,22,23,25,26) |
| InChIKey | ZEPWJUMZDYCKIJ-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 124.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.48 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |