C26H29N3O3S2 — CID 146610710
1-[amino-[4-(2-hydroxypropan-2-yl)-5-phenylthiophen-2-yl]-oxo-λ6-sulfanylidene]-3-(1,2,3,5,6,7-hexahydro-s-indacen-4-yl)urea (PubChem CID 146610710) has the molecular formula C26H29N3O3S2 and a molecular weight of 495.67 g/mol. Its IUPAC name is 1-[amino-[4-(2-hydroxypropan-2-yl)-5-phenylthiophen-2-yl]-oxo-λ6-sulfanylidene]-3-(1,2,3,5,6,7-hexahydro-s-indacen-4-yl)urea.
| Compound Name | 1-[amino-[4-(2-hydroxypropan-2-yl)-5-phenylthiophen-2-yl]-oxo-λ6-sulfanylidene]-3-(1,2,3,5,6,7-hexahydro-s-indacen-4-yl)urea |
|---|---|
| PubChem CID | 146610710 |
| Molecular Formula | C26H29N3O3S2 |
| Molecular Weight | 495.67 g/mol |
| Exact Mass | 495.17 |
| IUPAC Name | 1-[amino-[4-(2-hydroxypropan-2-yl)-5-phenylthiophen-2-yl]-oxo-λ6-sulfanylidene]-3-(1,2,3,5,6,7-hexahydro-s-indacen-4-yl)urea |
| SMILES | CC(C)(O)c1cc(S(N)(=O)=NC(=O)Nc2c3c(cc4c2CCC4)CCC3)sc1-c1ccccc1 |
| InChI | InChI=1S/C26H29N3O3S2/c1-26(2,31)21-15-22(33-24(21)16-8-4-3-5-9-16)34(27,32)29-25(30)28-23-19-12-6-10-17(19)14-18-11-7-13-20(18)23/h3-5,8-9,14-15,31H,6-7,10-13H2,1-2H3,(H3,27,28,29,30,32) |
| InChIKey | XPGMSNKMOPNCPV-UHFFFAOYSA-N |
| XLogP | 5.55 |
| TPSA | 104.78 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.67 |
| LogP ≤ 5 | 5.55 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |