C26H33N5O3S — CID 142522767
1-[amino-[3-(2-hydroxypropan-2-yl)-5-methyl-2-phenyl-1H-pyrazol-5-yl]-oxo-λ6-sulfanylidene]-3-(1,2,3,5,6,7-hexahydro-s-indacen-4-yl)urea (PubChem CID 142522767) has the molecular formula C26H33N5O3S and a molecular weight of 495.65 g/mol. Its IUPAC name is 1-[amino-[3-(2-hydroxypropan-2-yl)-5-methyl-2-phenyl-1H-pyrazol-5-yl]-oxo-λ6-sulfanylidene]-3-(1,2,3,5,6,7-hexahydro-s-indacen-4-yl)urea.
| Compound Name | 1-[amino-[3-(2-hydroxypropan-2-yl)-5-methyl-2-phenyl-1H-pyrazol-5-yl]-oxo-λ6-sulfanylidene]-3-(1,2,3,5,6,7-hexahydro-s-indacen-4-yl)urea |
|---|---|
| PubChem CID | 142522767 |
| Molecular Formula | C26H33N5O3S |
| Molecular Weight | 495.65 g/mol |
| Exact Mass | 495.23 |
| IUPAC Name | 1-[amino-[3-(2-hydroxypropan-2-yl)-5-methyl-2-phenyl-1H-pyrazol-5-yl]-oxo-λ6-sulfanylidene]-3-(1,2,3,5,6,7-hexahydro-s-indacen-4-yl)urea |
| SMILES | CC(C)(O)C1=CC(C)(S(N)(=O)=NC(=O)Nc2c3c(cc4c2CCC4)CCC3)NN1c1ccccc1 |
| InChI | InChI=1S/C26H33N5O3S/c1-25(2,33)22-16-26(3,30-31(22)19-11-5-4-6-12-19)35(27,34)29-24(32)28-23-20-13-7-9-17(20)15-18-10-8-14-21(18)23/h4-6,11-12,15-16,30,33H,7-10,13-14H2,1-3H3,(H3,27,28,29,32,34) |
| InChIKey | FPMSBRCCCNKYNZ-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 120.05 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.65 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |