C22H27N3O3S2 — CID 146610930
1-[amino-(5-methoxy-4,5,6,7-tetrahydro-2-benzothiophen-1-yl)-oxo-λ6-sulfanylidene]-3-(1,2,3,5,6,7-hexahydro-s-indacen-4-yl)urea (PubChem CID 146610930) has the molecular formula C22H27N3O3S2 and a molecular weight of 445.61 g/mol. Its IUPAC name is 1-[amino-(5-methoxy-4,5,6,7-tetrahydro-2-benzothiophen-1-yl)-oxo-λ6-sulfanylidene]-3-(1,2,3,5,6,7-hexahydro-s-indacen-4-yl)urea.
| Compound Name | 1-[amino-(5-methoxy-4,5,6,7-tetrahydro-2-benzothiophen-1-yl)-oxo-λ6-sulfanylidene]-3-(1,2,3,5,6,7-hexahydro-s-indacen-4-yl)urea |
|---|---|
| PubChem CID | 146610930 |
| Molecular Formula | C22H27N3O3S2 |
| Molecular Weight | 445.61 g/mol |
| Exact Mass | 445.15 |
| IUPAC Name | 1-[amino-(5-methoxy-4,5,6,7-tetrahydro-2-benzothiophen-1-yl)-oxo-λ6-sulfanylidene]-3-(1,2,3,5,6,7-hexahydro-s-indacen-4-yl)urea |
| SMILES | COC1CCc2c(csc2S(N)(=O)=NC(=O)Nc2c3c(cc4c2CCC4)CCC3)C1 |
| InChI | InChI=1S/C22H27N3O3S2/c1-28-16-8-9-19-15(11-16)12-29-21(19)30(23,27)25-22(26)24-20-17-6-2-4-13(17)10-14-5-3-7-18(14)20/h10,12,16H,2-9,11H2,1H3,(H3,23,24,25,26,27) |
| InChIKey | SCNZISORMHDIBD-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 93.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.61 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |