C23H31N3O3S — CID 167348325
1-[amino-(4-tert-butyl-5-methylfuran-2-yl)-oxo-λ6-sulfanylidene]-3-(1-methyl-1,2,3,5,6,7-hexahydro-s-indacen-4-yl)urea (PubChem CID 167348325) has the molecular formula C23H31N3O3S and a molecular weight of 429.59 g/mol. Its IUPAC name is 1-[amino-(4-tert-butyl-5-methylfuran-2-yl)-oxo-λ6-sulfanylidene]-3-(1-methyl-1,2,3,5,6,7-hexahydro-s-indacen-4-yl)urea.
| Compound Name | 1-[amino-(4-tert-butyl-5-methylfuran-2-yl)-oxo-λ6-sulfanylidene]-3-(1-methyl-1,2,3,5,6,7-hexahydro-s-indacen-4-yl)urea |
|---|---|
| PubChem CID | 167348325 |
| Molecular Formula | C23H31N3O3S |
| Molecular Weight | 429.59 g/mol |
| Exact Mass | 429.21 |
| IUPAC Name | 1-[amino-(4-tert-butyl-5-methylfuran-2-yl)-oxo-λ6-sulfanylidene]-3-(1-methyl-1,2,3,5,6,7-hexahydro-s-indacen-4-yl)urea |
| SMILES | Cc1oc(S(N)(=O)=NC(=O)Nc2c3c(cc4c2CCC4C)CCC3)cc1C(C)(C)C |
| InChI | InChI=1S/C23H31N3O3S/c1-13-9-10-17-18(13)11-15-7-6-8-16(15)21(17)25-22(27)26-30(24,28)20-12-19(14(2)29-20)23(3,4)5/h11-13H,6-10H2,1-5H3,(H3,24,25,26,27,28) |
| InChIKey | MORXLSNLVJINOA-UHFFFAOYSA-N |
| XLogP | 5.36 |
| TPSA | 97.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.59 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |