C26H39N3O4SSi — CID 154662170
1-[[[tert-butyl(dimethyl)silyl]amino]-[4-(2-hydroxypropan-2-yl)furan-2-yl]-oxo-λ6-sulfanylidene]-3-(1,2,3,5,6,7-hexahydro-s-indacen-4-yl)urea (PubChem CID 154662170) has the molecular formula C26H39N3O4SSi and a molecular weight of 517.77 g/mol. Its IUPAC name is 1-[[[tert-butyl(dimethyl)silyl]amino]-[4-(2-hydroxypropan-2-yl)furan-2-yl]-oxo-λ6-sulfanylidene]-3-(1,2,3,5,6,7-hexahydro-s-indacen-4-yl)urea.
| Compound Name | 1-[[[tert-butyl(dimethyl)silyl]amino]-[4-(2-hydroxypropan-2-yl)furan-2-yl]-oxo-λ6-sulfanylidene]-3-(1,2,3,5,6,7-hexahydro-s-indacen-4-yl)urea |
|---|---|
| PubChem CID | 154662170 |
| Molecular Formula | C26H39N3O4SSi |
| Molecular Weight | 517.77 g/mol |
| Exact Mass | 517.24 |
| IUPAC Name | 1-[[[tert-butyl(dimethyl)silyl]amino]-[4-(2-hydroxypropan-2-yl)furan-2-yl]-oxo-λ6-sulfanylidene]-3-(1,2,3,5,6,7-hexahydro-s-indacen-4-yl)urea |
| SMILES | CC(C)(O)c1coc(S(=O)(=NC(=O)Nc2c3c(cc4c2CCC4)CCC3)N[Si](C)(C)C(C)(C)C)c1 |
| InChI | InChI=1S/C26H39N3O4SSi/c1-25(2,3)35(6,7)29-34(32,22-15-19(16-33-22)26(4,5)31)28-24(30)27-23-20-12-8-10-17(20)14-18-11-9-13-21(18)23/h14-16,31H,8-13H2,1-7H3,(H2,27,28,29,30,32) |
| InChIKey | ZLCIFAVKIHGMLW-UHFFFAOYSA-N |
| XLogP | 6.05 |
| TPSA | 103.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.77 |
| LogP ≤ 5 | 6.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|