C28H34N4O4S2 — CID 146570708
1-(1,2,3,5,6,7-hexahydro-s-indacen-4-yl)-3-[[2-(2-hydroxypropan-2-yl)-1,3-thiazol-5-yl]-[[(1R)-1-(4-methoxyphenyl)ethyl]amino]-oxo-λ6-sulfanylidene]urea (PubChem CID 146570708) has the molecular formula C28H34N4O4S2 and a molecular weight of 554.74 g/mol. Its IUPAC name is 1-(1,2,3,5,6,7-hexahydro-s-indacen-4-yl)-3-[[2-(2-hydroxypropan-2-yl)-1,3-thiazol-5-yl]-[[(1R)-1-(4-methoxyphenyl)ethyl]amino]-oxo-λ6-sulfanylidene]urea.
| Compound Name | 1-(1,2,3,5,6,7-hexahydro-s-indacen-4-yl)-3-[[2-(2-hydroxypropan-2-yl)-1,3-thiazol-5-yl]-[[(1R)-1-(4-methoxyphenyl)ethyl]amino]-oxo-λ6-sulfanylidene]urea |
|---|---|
| PubChem CID | 146570708 |
| Molecular Formula | C28H34N4O4S2 |
| Molecular Weight | 554.74 g/mol |
| Exact Mass | 554.20 |
| IUPAC Name | 1-(1,2,3,5,6,7-hexahydro-s-indacen-4-yl)-3-[[2-(2-hydroxypropan-2-yl)-1,3-thiazol-5-yl]-[[(1R)-1-(4-methoxyphenyl)ethyl]amino]-oxo-λ6-sulfanylidene]urea |
| SMILES | COc1ccc([C@@H](C)NS(=O)(=NC(=O)Nc2c3c(cc4c2CCC4)CCC3)c2cnc(C(C)(C)O)s2)cc1 |
| InChI | InChI=1S/C28H34N4O4S2/c1-17(18-11-13-21(36-4)14-12-18)31-38(35,24-16-29-26(37-24)28(2,3)34)32-27(33)30-25-22-9-5-7-19(22)15-20-8-6-10-23(20)25/h11-17,34H,5-10H2,1-4H3,(H2,30,31,32,33,35)/t17-,38?/m1/s1 |
| InChIKey | FZPJSVIVWVCICT-RMMAMLODSA-N |
| XLogP | 5.68 |
| TPSA | 112.91 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 554.74 |
| LogP ≤ 5 | 5.68 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |