C21H25N2O3S+ — CID 163789145
1,2,3,5,6,7-hexahydro-s-indacen-4-ylcarbamoylimino-[4-(2-hydroxypropan-2-yl)-5-methylfuran-2-yl]sulfanium (PubChem CID 163789145) has the molecular formula C21H25N2O3S+ and a molecular weight of 385.51 g/mol. Its IUPAC name is 1,2,3,5,6,7-hexahydro-s-indacen-4-ylcarbamoylimino-[4-(2-hydroxypropan-2-yl)-5-methylfuran-2-yl]sulfanium.
| Compound Name | 1,2,3,5,6,7-hexahydro-s-indacen-4-ylcarbamoylimino-[4-(2-hydroxypropan-2-yl)-5-methylfuran-2-yl]sulfanium |
|---|---|
| PubChem CID | 163789145 |
| Molecular Formula | C21H25N2O3S+ |
| Molecular Weight | 385.51 g/mol |
| Exact Mass | 385.16 |
| IUPAC Name | 1,2,3,5,6,7-hexahydro-s-indacen-4-ylcarbamoylimino-[4-(2-hydroxypropan-2-yl)-5-methylfuran-2-yl]sulfanium |
| SMILES | Cc1oc(/[S+]=N/C(=O)Nc2c3c(cc4c2CCC4)CCC3)cc1C(C)(C)O |
| InChI | InChI=1S/C21H24N2O3S/c1-12-17(21(2,3)25)11-18(26-12)27-23-20(24)22-19-15-8-4-6-13(15)10-14-7-5-9-16(14)19/h10-11,25H,4-9H2,1-3H3/p+1 |
| InChIKey | MVEBUQZECFQBFY-UHFFFAOYSA-O |
| XLogP | 4.65 |
| TPSA | 74.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.51 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|