C21H26N2O5S — CID 134247768
1-[4-(1,1,1,3,3,3-hexadeuterio-2-hydroxypropan-2-yl)-5-methylfuran-2-yl]sulfonyl-3-(1,2,3,5,6,7-hexahydro-s-indacen-4-yl)urea (PubChem CID 134247768) has the molecular formula C21H26N2O5S and a molecular weight of 424.55 g/mol. Its IUPAC name is 1-[4-(1,1,1,3,3,3-hexadeuterio-2-hydroxypropan-2-yl)-5-methylfuran-2-yl]sulfonyl-3-(1,2,3,5,6,7-hexahydro-s-indacen-4-yl)urea.
| Compound Name | 1-[4-(1,1,1,3,3,3-hexadeuterio-2-hydroxypropan-2-yl)-5-methylfuran-2-yl]sulfonyl-3-(1,2,3,5,6,7-hexahydro-s-indacen-4-yl)urea |
|---|---|
| PubChem CID | 134247768 |
| Molecular Formula | C21H26N2O5S |
| Molecular Weight | 424.55 g/mol |
| Exact Mass | 424.19 |
| IUPAC Name | 1-[4-(1,1,1,3,3,3-hexadeuterio-2-hydroxypropan-2-yl)-5-methylfuran-2-yl]sulfonyl-3-(1,2,3,5,6,7-hexahydro-s-indacen-4-yl)urea |
| SMILES | [2H]C([2H])([2H])C(O)(c1cc(S(=O)(=O)NC(=O)Nc2c3c(cc4c2CCC4)CCC3)oc1C)C([2H])([2H])[2H] |
| InChI | InChI=1S/C21H26N2O5S/c1-12-17(21(2,3)25)11-18(28-12)29(26,27)23-20(24)22-19-15-8-4-6-13(15)10-14-7-5-9-16(14)19/h10-11,25H,4-9H2,1-3H3,(H2,22,23,24)/i2D3,3D3 |
| InChIKey | NNLJKIFDJMUNEV-XERRXZQWSA-N |
| XLogP | 3.30 |
| TPSA | 108.64 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.55 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |