C23H27NO6S — CID 138571982
1,2,3,5,6,7-hexahydro-s-indacen-4-yl N-[5-cyclopropyl-4-(2-hydroxypropan-2-yl)furan-2-yl]sulfonylcarbamate (PubChem CID 138571982) has the molecular formula C23H27NO6S and a molecular weight of 445.54 g/mol. Its IUPAC name is 1,2,3,5,6,7-hexahydro-s-indacen-4-yl N-[5-cyclopropyl-4-(2-hydroxypropan-2-yl)furan-2-yl]sulfonylcarbamate.
| Compound Name | 1,2,3,5,6,7-hexahydro-s-indacen-4-yl N-[5-cyclopropyl-4-(2-hydroxypropan-2-yl)furan-2-yl]sulfonylcarbamate |
|---|---|
| PubChem CID | 138571982 |
| Molecular Formula | C23H27NO6S |
| Molecular Weight | 445.54 g/mol |
| Exact Mass | 445.16 |
| IUPAC Name | 1,2,3,5,6,7-hexahydro-s-indacen-4-yl N-[5-cyclopropyl-4-(2-hydroxypropan-2-yl)furan-2-yl]sulfonylcarbamate |
| SMILES | CC(C)(O)c1cc(S(=O)(=O)NC(=O)Oc2c3c(cc4c2CCC4)CCC3)oc1C1CC1 |
| InChI | InChI=1S/C23H27NO6S/c1-23(2,26)18-12-19(29-20(18)13-9-10-13)31(27,28)24-22(25)30-21-16-7-3-5-14(16)11-15-6-4-8-17(15)21/h11-13,26H,3-10H2,1-2H3,(H,24,25) |
| InChIKey | SCOFDJVVRUQERU-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 105.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.54 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |