C21H28N4O2S2 — CID 146610986
(R)-[[amino-(6-methyl-5,7-dihydro-4H-thieno[2,3-c]pyridin-2-yl)-oxo-λ6-sulfanylidene]amino]-(1,2,3,5,6,7-hexahydro-s-indacen-4-ylamino)methanol (PubChem CID 146610986) has the molecular formula C21H28N4O2S2 and a molecular weight of 432.62 g/mol. Its IUPAC name is (R)-[[amino-(6-methyl-5,7-dihydro-4H-thieno[2,3-c]pyridin-2-yl)-oxo-λ6-sulfanylidene]amino]-(1,2,3,5,6,7-hexahydro-s-indacen-4-ylamino)methanol.
| Compound Name | (R)-[[amino-(6-methyl-5,7-dihydro-4H-thieno[2,3-c]pyridin-2-yl)-oxo-λ6-sulfanylidene]amino]-(1,2,3,5,6,7-hexahydro-s-indacen-4-ylamino)methanol |
|---|---|
| PubChem CID | 146610986 |
| Molecular Formula | C21H28N4O2S2 |
| Molecular Weight | 432.62 g/mol |
| Exact Mass | 432.17 |
| IUPAC Name | (R)-[[amino-(6-methyl-5,7-dihydro-4H-thieno[2,3-c]pyridin-2-yl)-oxo-λ6-sulfanylidene]amino]-(1,2,3,5,6,7-hexahydro-s-indacen-4-ylamino)methanol |
| SMILES | CN1CCc2cc(S(N)(=O)=N[C@H](O)Nc3c4c(cc5c3CCC5)CCC4)sc2C1 |
| InChI | InChI=1S/C21H28N4O2S2/c1-25-9-8-15-11-19(28-18(15)12-25)29(22,27)24-21(26)23-20-16-6-2-4-13(16)10-14-5-3-7-17(14)20/h10-11,21,23,26H,2-9,12H2,1H3,(H2,22,24,27)/t21-,29?/m1/s1 |
| InChIKey | UDVDWNLQYOEMCI-QYWNIODHSA-N |
| XLogP | 2.80 |
| TPSA | 90.95 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.62 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|