C15H18N2O3S — CID 154997378
N-(1,2,3,5,6,7-hexahydro-s-indacen-4-yl)-2-sulfamoylprop-2-enamide (PubChem CID 154997378) has the molecular formula C15H18N2O3S and a molecular weight of 306.39 g/mol. Its IUPAC name is N-(1,2,3,5,6,7-hexahydro-s-indacen-4-yl)-2-sulfamoylprop-2-enamide.
| Compound Name | N-(1,2,3,5,6,7-hexahydro-s-indacen-4-yl)-2-sulfamoylprop-2-enamide |
|---|---|
| PubChem CID | 154997378 |
| Molecular Formula | C15H18N2O3S |
| Molecular Weight | 306.39 g/mol |
| Exact Mass | 306.10 |
| IUPAC Name | N-(1,2,3,5,6,7-hexahydro-s-indacen-4-yl)-2-sulfamoylprop-2-enamide |
| SMILES | C=C(C(=O)Nc1c2c(cc3c1CCC3)CCC2)S(N)(=O)=O |
| InChI | InChI=1S/C15H18N2O3S/c1-9(21(16,19)20)15(18)17-14-12-6-2-4-10(12)8-11-5-3-7-13(11)14/h8H,1-7H2,(H,17,18)(H2,16,19,20) |
| InChIKey | AVQUCGWRWHJVJE-UHFFFAOYSA-N |
| XLogP | 1.40 |
| TPSA | 89.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.39 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|