C22H24N2O5S — CID 134189008
methyl 1-[2-(1,2,3,5,6,7-hexahydro-s-indacen-4-ylcarbamoyl)prop-2-enylsulfonyl]pyrrole-3-carboxylate (PubChem CID 134189008) has the molecular formula C22H24N2O5S and a molecular weight of 428.51 g/mol. Its IUPAC name is methyl 1-[2-(1,2,3,5,6,7-hexahydro-s-indacen-4-ylcarbamoyl)prop-2-enylsulfonyl]pyrrole-3-carboxylate.
| Compound Name | methyl 1-[2-(1,2,3,5,6,7-hexahydro-s-indacen-4-ylcarbamoyl)prop-2-enylsulfonyl]pyrrole-3-carboxylate |
|---|---|
| PubChem CID | 134189008 |
| Molecular Formula | C22H24N2O5S |
| Molecular Weight | 428.51 g/mol |
| Exact Mass | 428.14 |
| IUPAC Name | methyl 1-[2-(1,2,3,5,6,7-hexahydro-s-indacen-4-ylcarbamoyl)prop-2-enylsulfonyl]pyrrole-3-carboxylate |
| SMILES | C=C(CS(=O)(=O)n1ccc(C(=O)OC)c1)C(=O)Nc1c2c(cc3c1CCC3)CCC2 |
| InChI | InChI=1S/C22H24N2O5S/c1-14(13-30(27,28)24-10-9-17(12-24)22(26)29-2)21(25)23-20-18-7-3-5-15(18)11-16-6-4-8-19(16)20/h9-12H,1,3-8,13H2,2H3,(H,23,25) |
| InChIKey | NOOVIHCRBFTKNJ-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 94.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.51 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|