C28H26FN5O2S2 — CID 153356818
benzyl N-[[2-fluorosulfanyl-5-(1,2,3,5,6,7-hexahydro-s-indacen-4-ylamino)-1,2,4-triazol-3-yl]-phenyl-λ4-sulfanylidene]carbamate (PubChem CID 153356818) has the molecular formula C28H26FN5O2S2 and a molecular weight of 547.68 g/mol. Its IUPAC name is benzyl N-[[2-fluorosulfanyl-5-(1,2,3,5,6,7-hexahydro-s-indacen-4-ylamino)-1,2,4-triazol-3-yl]-phenyl-λ4-sulfanylidene]carbamate.
| Compound Name | benzyl N-[[2-fluorosulfanyl-5-(1,2,3,5,6,7-hexahydro-s-indacen-4-ylamino)-1,2,4-triazol-3-yl]-phenyl-λ4-sulfanylidene]carbamate |
|---|---|
| PubChem CID | 153356818 |
| Molecular Formula | C28H26FN5O2S2 |
| Molecular Weight | 547.68 g/mol |
| Exact Mass | 547.15 |
| IUPAC Name | benzyl N-[[2-fluorosulfanyl-5-(1,2,3,5,6,7-hexahydro-s-indacen-4-ylamino)-1,2,4-triazol-3-yl]-phenyl-λ4-sulfanylidene]carbamate |
| SMILES | O=C(N=S(c1ccccc1)c1nc(Nc2c3c(cc4c2CCC4)CCC3)nn1SF)OCc1ccccc1 |
| InChI | InChI=1S/C28H26FN5O2S2/c29-37-34-27(31-26(32-34)30-25-23-15-7-11-20(23)17-21-12-8-16-24(21)25)38(22-13-5-2-6-14-22)33-28(35)36-18-19-9-3-1-4-10-19/h1-6,9-10,13-14,17H,7-8,11-12,15-16,18H2,(H,30,32) |
| InChIKey | ZJOORWXNHLJZBT-UHFFFAOYSA-N |
| XLogP | 6.94 |
| TPSA | 81.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 547.68 |
| LogP ≤ 5 | 6.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |