C18H20N4O2 — CID 154663517
ethyl 4-(1,2,3,5,6,7-hexahydro-s-indacen-4-ylamino)-1,3,5-triazine-2-carboxylate (PubChem CID 154663517) has the molecular formula C18H20N4O2 and a molecular weight of 324.38 g/mol. Its IUPAC name is ethyl 4-(1,2,3,5,6,7-hexahydro-s-indacen-4-ylamino)-1,3,5-triazine-2-carboxylate.
| Compound Name | ethyl 4-(1,2,3,5,6,7-hexahydro-s-indacen-4-ylamino)-1,3,5-triazine-2-carboxylate |
|---|---|
| PubChem CID | 154663517 |
| Molecular Formula | C18H20N4O2 |
| Molecular Weight | 324.38 g/mol |
| Exact Mass | 324.16 |
| IUPAC Name | ethyl 4-(1,2,3,5,6,7-hexahydro-s-indacen-4-ylamino)-1,3,5-triazine-2-carboxylate |
| SMILES | CCOC(=O)c1ncnc(Nc2c3c(cc4c2CCC4)CCC3)n1 |
| InChI | InChI=1S/C18H20N4O2/c1-2-24-17(23)16-19-10-20-18(22-16)21-15-13-7-3-5-11(13)9-12-6-4-8-14(12)15/h9-10H,2-8H2,1H3,(H,19,20,21,22) |
| InChIKey | WNMRWQAHRWZPJL-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 77.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.38 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |