C23H33NO7 — CID 158499287
ethyl (2R)-2-(1,2,3,5,6,7-hexahydro-s-indacen-4-ylcarbamoyloxy)propanoate;ethyl (2R)-2-hydroxypropanoate (PubChem CID 158499287) has the molecular formula C23H33NO7 and a molecular weight of 435.52 g/mol. Its IUPAC name is ethyl (2R)-2-(1,2,3,5,6,7-hexahydro-s-indacen-4-ylcarbamoyloxy)propanoate;ethyl (2R)-2-hydroxypropanoate.
| Compound Name | ethyl (2R)-2-(1,2,3,5,6,7-hexahydro-s-indacen-4-ylcarbamoyloxy)propanoate;ethyl (2R)-2-hydroxypropanoate |
|---|---|
| PubChem CID | 158499287 |
| Molecular Formula | C23H33NO7 |
| Molecular Weight | 435.52 g/mol |
| Exact Mass | 435.23 |
| IUPAC Name | ethyl (2R)-2-(1,2,3,5,6,7-hexahydro-s-indacen-4-ylcarbamoyloxy)propanoate;ethyl (2R)-2-hydroxypropanoate |
| SMILES | CCOC(=O)[C@@H](C)O.CCOC(=O)[C@@H](C)OC(=O)Nc1c2c(cc3c1CCC3)CCC2 |
| InChI | InChI=1S/C18H23NO4.C5H10O3/c1-3-22-17(20)11(2)23-18(21)19-16-14-8-4-6-12(14)10-13-7-5-9-15(13)16;1-3-8-5(7)4(2)6/h10-11H,3-9H2,1-2H3,(H,19,21);4,6H,3H2,1-2H3/t11-;4-/m11/s1 |
| InChIKey | HJRPISQVRCAVCP-GFEFYVLUSA-N |
| XLogP | 3.09 |
| TPSA | 111.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.52 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|