C38H57NO14 — CID 159762395
ethyl (2R)-2-(1,2,3,5,6,7-hexahydro-s-indacen-4-ylcarbamoyloxy)-3-(oxan-4-yloxy)propanoate;ethyl (2R)-2-hydroxy-3-(oxan-4-yloxy)propanoate;ethyl (2R)-oxirane-2-carboxylate (PubChem CID 159762395) has the molecular formula C38H57NO14 and a molecular weight of 751.87 g/mol. Its IUPAC name is ethyl (2R)-2-(1,2,3,5,6,7-hexahydro-s-indacen-4-ylcarbamoyloxy)-3-(oxan-4-yloxy)propanoate;ethyl (2R)-2-hydroxy-3-(oxan-4-yloxy)propanoate;ethyl (2R)-oxirane-2-carboxylate.
| Compound Name | ethyl (2R)-2-(1,2,3,5,6,7-hexahydro-s-indacen-4-ylcarbamoyloxy)-3-(oxan-4-yloxy)propanoate;ethyl (2R)-2-hydroxy-3-(oxan-4-yloxy)propanoate;ethyl (2R)-oxirane-2-carboxylate |
|---|---|
| PubChem CID | 159762395 |
| Molecular Formula | C38H57NO14 |
| Molecular Weight | 751.87 g/mol |
| Exact Mass | 751.38 |
| IUPAC Name | ethyl (2R)-2-(1,2,3,5,6,7-hexahydro-s-indacen-4-ylcarbamoyloxy)-3-(oxan-4-yloxy)propanoate;ethyl (2R)-2-hydroxy-3-(oxan-4-yloxy)propanoate;ethyl (2R)-oxirane-2-carboxylate |
| SMILES | CCOC(=O)[C@@H](COC1CCOCC1)OC(=O)Nc1c2c(cc3c1CCC3)CCC2.CCOC(=O)[C@H](O)COC1CCOCC1.CCOC(=O)[C@H]1CO1 |
| InChI | InChI=1S/C23H31NO6.C10H18O5.C5H8O3/c1-2-28-22(25)20(14-29-17-9-11-27-12-10-17)30-23(26)24-21-18-7-3-5-15(18)13-16-6-4-8-19(16)21;1-2-14-10(12)9(11)7-15-8-3-5-13-6-4-8;1-2-7-5(6)4-3-8-4/h13,17,20H,2-12,14H2,1H3,(H,24,26);8-9,11H,2-7H2,1H3;4H,2-3H2,1H3/t20-;9-;4-/m111/s1 |
| InChIKey | NFBFRGFIKJQNRJ-WKZMFHTISA-N |
| XLogP | 3.39 |
| TPSA | 186.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 751.87 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|