C25H29N3O4 — CID 150754243
cyclopentyl (2R)-2-(1,2,3,5,6,7-hexahydro-s-indacen-4-ylcarbamoyloxy)-3-pyrimidin-2-ylpropanoate (PubChem CID 150754243) has the molecular formula C25H29N3O4 and a molecular weight of 435.52 g/mol. Its IUPAC name is cyclopentyl (2R)-2-(1,2,3,5,6,7-hexahydro-s-indacen-4-ylcarbamoyloxy)-3-pyrimidin-2-ylpropanoate.
| Compound Name | cyclopentyl (2R)-2-(1,2,3,5,6,7-hexahydro-s-indacen-4-ylcarbamoyloxy)-3-pyrimidin-2-ylpropanoate |
|---|---|
| PubChem CID | 150754243 |
| Molecular Formula | C25H29N3O4 |
| Molecular Weight | 435.52 g/mol |
| Exact Mass | 435.22 |
| IUPAC Name | cyclopentyl (2R)-2-(1,2,3,5,6,7-hexahydro-s-indacen-4-ylcarbamoyloxy)-3-pyrimidin-2-ylpropanoate |
| SMILES | O=C(Nc1c2c(cc3c1CCC3)CCC2)O[C@H](Cc1ncccn1)C(=O)OC1CCCC1 |
| InChI | InChI=1S/C25H29N3O4/c29-24(31-18-8-1-2-9-18)21(15-22-26-12-5-13-27-22)32-25(30)28-23-19-10-3-6-16(19)14-17-7-4-11-20(17)23/h5,12-14,18,21H,1-4,6-11,15H2,(H,28,30)/t21-/m1/s1 |
| InChIKey | JWNAQLNHDHFHEX-OAQYLSRUSA-N |
| XLogP | 4.10 |
| TPSA | 90.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.52 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |