C21H31ClN4OSi — CID 153357006
5-(chloromethyl)-N-(1,2,3,5,6,7-hexahydro-s-indacen-4-yl)-4-(2-trimethylsilylethoxymethyl)-1,2,4-triazol-3-amine (PubChem CID 153357006) has the molecular formula C21H31ClN4OSi and a molecular weight of 419.05 g/mol. Its IUPAC name is 5-(chloromethyl)-N-(1,2,3,5,6,7-hexahydro-s-indacen-4-yl)-4-(2-trimethylsilylethoxymethyl)-1,2,4-triazol-3-amine.
| Compound Name | 5-(chloromethyl)-N-(1,2,3,5,6,7-hexahydro-s-indacen-4-yl)-4-(2-trimethylsilylethoxymethyl)-1,2,4-triazol-3-amine |
|---|---|
| PubChem CID | 153357006 |
| Molecular Formula | C21H31ClN4OSi |
| Molecular Weight | 419.05 g/mol |
| Exact Mass | 418.20 |
| IUPAC Name | 5-(chloromethyl)-N-(1,2,3,5,6,7-hexahydro-s-indacen-4-yl)-4-(2-trimethylsilylethoxymethyl)-1,2,4-triazol-3-amine |
| SMILES | C[Si](C)(C)CCOCn1c(CCl)nnc1Nc1c2c(cc3c1CCC3)CCC2 |
| InChI | InChI=1S/C21H31ClN4OSi/c1-28(2,3)11-10-27-14-26-19(13-22)24-25-21(26)23-20-17-8-4-6-15(17)12-16-7-5-9-18(16)20/h12H,4-11,13-14H2,1-3H3,(H,23,25) |
| InChIKey | NEHWUYHLZJXHAZ-UHFFFAOYSA-N |
| XLogP | 5.05 |
| TPSA | 51.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.05 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|