C27H33N5O3Si — CID 90391087
5-[3-(2-morpholin-4-yl-4-pyridinyl)-1-(2-trimethylsilylethoxymethyl)indazol-5-yl]-1H-pyridin-2-one (PubChem CID 90391087) has the molecular formula C27H33N5O3Si and a molecular weight of 503.68 g/mol. Its IUPAC name is 5-[3-(2-morpholin-4-yl-4-pyridinyl)-1-(2-trimethylsilylethoxymethyl)indazol-5-yl]-1H-pyridin-2-one.
| Compound Name | 5-[3-(2-morpholin-4-yl-4-pyridinyl)-1-(2-trimethylsilylethoxymethyl)indazol-5-yl]-1H-pyridin-2-one |
|---|---|
| PubChem CID | 90391087 |
| Molecular Formula | C27H33N5O3Si |
| Molecular Weight | 503.68 g/mol |
| Exact Mass | 503.24 |
| IUPAC Name | 5-[3-(2-morpholin-4-yl-4-pyridinyl)-1-(2-trimethylsilylethoxymethyl)indazol-5-yl]-1H-pyridin-2-one |
| SMILES | C[Si](C)(C)CCOCn1nc(-c2ccnc(N3CCOCC3)c2)c2cc(-c3ccc(=O)[nH]c3)ccc21 |
| InChI | InChI=1S/C27H33N5O3Si/c1-36(2,3)15-14-35-19-32-24-6-4-20(22-5-7-26(33)29-18-22)16-23(24)27(30-32)21-8-9-28-25(17-21)31-10-12-34-13-11-31/h4-9,16-18H,10-15,19H2,1-3H3,(H,29,33) |
| InChIKey | INFNTDTZXZXRAQ-UHFFFAOYSA-N |
| XLogP | 4.60 |
| TPSA | 85.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.68 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|