C23H33N5O2Si — CID 140850879
3-[4-(4-methylpiperazin-1-yl)phenyl]-1-(2-trimethylsilylethoxymethyl)-5H-pyrazolo[4,3-c]pyridin-6-one (PubChem CID 140850879) has the molecular formula C23H33N5O2Si and a molecular weight of 439.64 g/mol. Its IUPAC name is 3-[4-(4-methylpiperazin-1-yl)phenyl]-1-(2-trimethylsilylethoxymethyl)-5H-pyrazolo[4,3-c]pyridin-6-one.
| Compound Name | 3-[4-(4-methylpiperazin-1-yl)phenyl]-1-(2-trimethylsilylethoxymethyl)-5H-pyrazolo[4,3-c]pyridin-6-one |
|---|---|
| PubChem CID | 140850879 |
| Molecular Formula | C23H33N5O2Si |
| Molecular Weight | 439.64 g/mol |
| Exact Mass | 439.24 |
| IUPAC Name | 3-[4-(4-methylpiperazin-1-yl)phenyl]-1-(2-trimethylsilylethoxymethyl)-5H-pyrazolo[4,3-c]pyridin-6-one |
| SMILES | CN1CCN(c2ccc(-c3nn(COCC[Si](C)(C)C)c4cc(=O)[nH]cc34)cc2)CC1 |
| InChI | InChI=1S/C23H33N5O2Si/c1-26-9-11-27(12-10-26)19-7-5-18(6-8-19)23-20-16-24-22(29)15-21(20)28(25-23)17-30-13-14-31(2,3)4/h5-8,15-16H,9-14,17H2,1-4H3,(H,24,29) |
| InChIKey | GFRMPQIRHNMEBJ-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 66.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.64 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|