C24H34N4O2Si — CID 158465034
3-[4-(4-methylpiperazin-1-yl)phenyl]-1-(2-trimethylsilylethoxymethyl)-5H-indazol-6-one (PubChem CID 158465034) has the molecular formula C24H34N4O2Si and a molecular weight of 438.65 g/mol. Its IUPAC name is 3-[4-(4-methylpiperazin-1-yl)phenyl]-1-(2-trimethylsilylethoxymethyl)-5H-indazol-6-one.
| Compound Name | 3-[4-(4-methylpiperazin-1-yl)phenyl]-1-(2-trimethylsilylethoxymethyl)-5H-indazol-6-one |
|---|---|
| PubChem CID | 158465034 |
| Molecular Formula | C24H34N4O2Si |
| Molecular Weight | 438.65 g/mol |
| Exact Mass | 438.25 |
| IUPAC Name | 3-[4-(4-methylpiperazin-1-yl)phenyl]-1-(2-trimethylsilylethoxymethyl)-5H-indazol-6-one |
| SMILES | CN1CCN(c2ccc(-c3nn(COCC[Si](C)(C)C)c4c3=CCC(=O)C=4)cc2)CC1 |
| InChI | InChI=1S/C24H34N4O2Si/c1-26-11-13-27(14-12-26)20-7-5-19(6-8-20)24-22-10-9-21(29)17-23(22)28(25-24)18-30-15-16-31(2,3)4/h5-8,10,17H,9,11-16,18H2,1-4H3 |
| InChIKey | HFQOKCBFUUJAPD-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 50.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.65 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|