C31H37F2N7OSi — CID 164594054
2,4-difluoro-3-[1-[6-(4-methylpiperazin-1-yl)-1-(2-trimethylsilylethoxymethyl)benzimidazol-2-yl]imidazo[1,5-a]pyridin-6-yl]aniline (PubChem CID 164594054) has the molecular formula C31H37F2N7OSi and a molecular weight of 589.77 g/mol. Its IUPAC name is 2,4-difluoro-3-[1-[6-(4-methylpiperazin-1-yl)-1-(2-trimethylsilylethoxymethyl)benzimidazol-2-yl]imidazo[1,5-a]pyridin-6-yl]aniline.
| Compound Name | 2,4-difluoro-3-[1-[6-(4-methylpiperazin-1-yl)-1-(2-trimethylsilylethoxymethyl)benzimidazol-2-yl]imidazo[1,5-a]pyridin-6-yl]aniline |
|---|---|
| PubChem CID | 164594054 |
| Molecular Formula | C31H37F2N7OSi |
| Molecular Weight | 589.77 g/mol |
| Exact Mass | 589.28 |
| IUPAC Name | 2,4-difluoro-3-[1-[6-(4-methylpiperazin-1-yl)-1-(2-trimethylsilylethoxymethyl)benzimidazol-2-yl]imidazo[1,5-a]pyridin-6-yl]aniline |
| SMILES | CN1CCN(c2ccc3nc(-c4ncn5cc(-c6c(F)ccc(N)c6F)ccc45)n(COCC[Si](C)(C)C)c3c2)CC1 |
| InChI | InChI=1S/C31H37F2N7OSi/c1-37-11-13-38(14-12-37)22-6-9-25-27(17-22)40(20-41-15-16-42(2,3)4)31(36-25)30-26-10-5-21(18-39(26)19-35-30)28-23(32)7-8-24(34)29(28)33/h5-10,17-19H,11-16,20,34H2,1-4H3 |
| InChIKey | BFZMQSGTAIKEKS-UHFFFAOYSA-N |
| XLogP | 5.94 |
| TPSA | 76.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 589.77 |
| LogP ≤ 5 | 5.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|