C14H11F2N3 — CID 164594272
2,4-difluoro-3-(1-methylimidazo[1,5-a]pyridin-6-yl)aniline (PubChem CID 164594272) has the molecular formula C14H11F2N3 and a molecular weight of 259.26 g/mol. Its IUPAC name is 2,4-difluoro-3-(1-methylimidazo[1,5-a]pyridin-6-yl)aniline.
| Compound Name | 2,4-difluoro-3-(1-methylimidazo[1,5-a]pyridin-6-yl)aniline |
|---|---|
| PubChem CID | 164594272 |
| Molecular Formula | C14H11F2N3 |
| Molecular Weight | 259.26 g/mol |
| Exact Mass | 259.09 |
| IUPAC Name | 2,4-difluoro-3-(1-methylimidazo[1,5-a]pyridin-6-yl)aniline |
| SMILES | Cc1ncn2cc(-c3c(F)ccc(N)c3F)ccc12 |
| InChI | InChI=1S/C14H11F2N3/c1-8-12-5-2-9(6-19(12)7-18-8)13-10(15)3-4-11(17)14(13)16/h2-7H,17H2,1H3 |
| InChIKey | ALIIMEIBTSFXCH-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 43.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.26 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|