About 3-(4,5-dimethyl-1,3-oxazol-2-yl)-2,4-difluoroaniline
3-(4,5-dimethyl-1,3-oxazol-2-yl)-2,4-difluoroaniline (PubChem CID 79773558) has the molecular formula C11H10F2N2O
and a molecular weight of 224.21 g/mol. Its IUPAC name is 3-(4,5-dimethyl-1,3-oxazol-2-yl)-2,4-difluoroaniline.
Molecular Properties
| Compound Name | 3-(4,5-dimethyl-1,3-oxazol-2-yl)-2,4-difluoroaniline |
| PubChem CID | 79773558 |
| Molecular Formula | C11H10F2N2O |
| Molecular Weight | 224.21 g/mol |
| Exact Mass | 224.08 |
| IUPAC Name | 3-(4,5-dimethyl-1,3-oxazol-2-yl)-2,4-difluoroaniline |
| SMILES | Cc1nc(-c2c(F)ccc(N)c2F)oc1C |
| InChI | InChI=1S/C11H10F2N2O/c1-5-6(2)16-11(15-5)9-7(12)3-4-8(14)10(9)13/h3-4H,14H2,1-2H3 |
| InChIKey | DOAFJUCCOSLVKD-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 52.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 224.21 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 3-(4,5-dimethyl-1,3-oxazol-2-yl)-2,4-difluoroaniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(4,5-dimethyl-1,3-oxazol-2-yl)-2,4-difluoroaniline?
The IUPAC name of 3-(4,5-dimethyl-1,3-oxazol-2-yl)-2,4-difluoroaniline (CID 79773558) is 3-(4,5-dimethyl-1,3-oxazol-2-yl)-2,4-difluoroaniline.
What is the SMILES notation for 3-(4,5-dimethyl-1,3-oxazol-2-yl)-2,4-difluoroaniline?
The canonical SMILES for 3-(4,5-dimethyl-1,3-oxazol-2-yl)-2,4-difluoroaniline is Cc1nc(-c2c(F)ccc(N)c2F)oc1C.
What is the InChIKey of 3-(4,5-dimethyl-1,3-oxazol-2-yl)-2,4-difluoroaniline?
The InChIKey is DOAFJUCCOSLVKD-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H10F2N2O/c1-5-6(2)16-11(15-5)9-7(12)3-4-8(14)10(9)13/h3-4H,14H2,1-2H3.
What are the key properties of 3-(4,5-dimethyl-1,3-oxazol-2-yl)-2,4-difluoroaniline?
3-(4,5-dimethyl-1,3-oxazol-2-yl)-2,4-difluoroaniline has a molecular weight of 224.21 g/mol, XLogP of 2.82, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(4,5-dimethyl-1,3-oxazol-2-yl)-2,4-difluoroaniline is sourced from PubChem (CID 79773558), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).