C11H10F2N2O — CID 79773558
3-(4,5-dimethyl-1,3-oxazol-2-yl)-2,4-difluoroaniline (PubChem CID 79773558) has the molecular formula C11H10F2N2O and a molecular weight of 224.21 g/mol. Its IUPAC name is 3-(4,5-dimethyl-1,3-oxazol-2-yl)-2,4-difluoroaniline.
| Compound Name | 3-(4,5-dimethyl-1,3-oxazol-2-yl)-2,4-difluoroaniline |
|---|---|
| PubChem CID | 79773558 |
| Molecular Formula | C11H10F2N2O |
| Molecular Weight | 224.21 g/mol |
| Exact Mass | 224.08 |
| IUPAC Name | 3-(4,5-dimethyl-1,3-oxazol-2-yl)-2,4-difluoroaniline |
| SMILES | Cc1nc(-c2c(F)ccc(N)c2F)oc1C |
| InChI | InChI=1S/C11H10F2N2O/c1-5-6(2)16-11(15-5)9-7(12)3-4-8(14)10(9)13/h3-4H,14H2,1-2H3 |
| InChIKey | DOAFJUCCOSLVKD-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 52.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.21 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|