C12H7BrF3N — CID 106943233
4-(3-bromo-2,6-difluorophenyl)-2-fluoroaniline (PubChem CID 106943233) has the molecular formula C12H7BrF3N and a molecular weight of 302.09 g/mol. Its IUPAC name is 4-(3-bromo-2,6-difluorophenyl)-2-fluoroaniline.
| Compound Name | 4-(3-bromo-2,6-difluorophenyl)-2-fluoroaniline |
|---|---|
| PubChem CID | 106943233 |
| Molecular Formula | C12H7BrF3N |
| Molecular Weight | 302.09 g/mol |
| Exact Mass | 300.97 |
| IUPAC Name | 4-(3-bromo-2,6-difluorophenyl)-2-fluoroaniline |
| SMILES | Nc1ccc(-c2c(F)ccc(Br)c2F)cc1F |
| InChI | InChI=1S/C12H7BrF3N/c13-7-2-3-8(14)11(12(7)16)6-1-4-10(17)9(15)5-6/h1-5H,17H2 |
| InChIKey | UOQFLDNZVFLABP-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.09 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|