C15H14BrF2N — CID 106943271
N-[[4-(3-bromo-2,6-difluorophenyl)phenyl]methyl]ethanamine (PubChem CID 106943271) has the molecular formula C15H14BrF2N and a molecular weight of 326.18 g/mol. Its IUPAC name is N-[[4-(3-bromo-2,6-difluorophenyl)phenyl]methyl]ethanamine.
| Compound Name | N-[[4-(3-bromo-2,6-difluorophenyl)phenyl]methyl]ethanamine |
|---|---|
| PubChem CID | 106943271 |
| Molecular Formula | C15H14BrF2N |
| Molecular Weight | 326.18 g/mol |
| Exact Mass | 325.03 |
| IUPAC Name | N-[[4-(3-bromo-2,6-difluorophenyl)phenyl]methyl]ethanamine |
| SMILES | CCNCc1ccc(-c2c(F)ccc(Br)c2F)cc1 |
| InChI | InChI=1S/C15H14BrF2N/c1-2-19-9-10-3-5-11(6-4-10)14-13(17)8-7-12(16)15(14)18/h3-8,19H,2,9H2,1H3 |
| InChIKey | YBZOVLQPWALGNO-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.18 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|