C15H11F2N3O2 — CID 164594267
methyl 7-(3-amino-2,6-difluorophenyl)imidazo[1,5-a]pyridine-3-carboxylate (PubChem CID 164594267) has the molecular formula C15H11F2N3O2 and a molecular weight of 303.27 g/mol. Its IUPAC name is methyl 7-(3-amino-2,6-difluorophenyl)imidazo[1,5-a]pyridine-3-carboxylate.
| Compound Name | methyl 7-(3-amino-2,6-difluorophenyl)imidazo[1,5-a]pyridine-3-carboxylate |
|---|---|
| PubChem CID | 164594267 |
| Molecular Formula | C15H11F2N3O2 |
| Molecular Weight | 303.27 g/mol |
| Exact Mass | 303.08 |
| IUPAC Name | methyl 7-(3-amino-2,6-difluorophenyl)imidazo[1,5-a]pyridine-3-carboxylate |
| SMILES | COC(=O)c1ncc2cc(-c3c(F)ccc(N)c3F)ccn12 |
| InChI | InChI=1S/C15H11F2N3O2/c1-22-15(21)14-19-7-9-6-8(4-5-20(9)14)12-10(16)2-3-11(18)13(12)17/h2-7H,18H2,1H3 |
| InChIKey | HEMPIXFBXHBZAN-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 69.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.27 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|