C19H20ClN3O5 — CID 11851979
ethyl 2-[3-(4-amino-3-methoxybenzoyl)imidazo[1,5-a]pyridin-7-yl]oxyacetate;hydrochloride (PubChem CID 11851979) has the molecular formula C19H20ClN3O5 and a molecular weight of 405.84 g/mol. Its IUPAC name is ethyl 2-[3-(4-amino-3-methoxybenzoyl)imidazo[1,5-a]pyridin-7-yl]oxyacetate;hydrochloride.
| Compound Name | ethyl 2-[3-(4-amino-3-methoxybenzoyl)imidazo[1,5-a]pyridin-7-yl]oxyacetate;hydrochloride |
|---|---|
| PubChem CID | 11851979 |
| Molecular Formula | C19H20ClN3O5 |
| Molecular Weight | 405.84 g/mol |
| Exact Mass | 405.11 |
| IUPAC Name | ethyl 2-[3-(4-amino-3-methoxybenzoyl)imidazo[1,5-a]pyridin-7-yl]oxyacetate;hydrochloride |
| SMILES | CCOC(=O)COc1ccn2c(C(=O)c3ccc(N)c(OC)c3)ncc2c1.Cl |
| InChI | InChI=1S/C19H19N3O5.ClH/c1-3-26-17(23)11-27-14-6-7-22-13(9-14)10-21-19(22)18(24)12-4-5-15(20)16(8-12)25-2;/h4-10H,3,11,20H2,1-2H3;1H |
| InChIKey | UDJPHCYKQBKVCQ-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 105.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.84 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|