C13H17NO5 — CID 10611863
ethyl 2-[4-amino-3-(1,3-dioxolan-2-yl)phenoxy]acetate (PubChem CID 10611863) has the molecular formula C13H17NO5 and a molecular weight of 267.28 g/mol. Its IUPAC name is ethyl 2-[4-amino-3-(1,3-dioxolan-2-yl)phenoxy]acetate.
| Compound Name | ethyl 2-[4-amino-3-(1,3-dioxolan-2-yl)phenoxy]acetate |
|---|---|
| PubChem CID | 10611863 |
| Molecular Formula | C13H17NO5 |
| Molecular Weight | 267.28 g/mol |
| Exact Mass | 267.11 |
| IUPAC Name | ethyl 2-[4-amino-3-(1,3-dioxolan-2-yl)phenoxy]acetate |
| SMILES | CCOC(=O)COc1ccc(N)c(C2OCCO2)c1 |
| InChI | InChI=1S/C13H17NO5/c1-2-16-12(15)8-19-9-3-4-11(14)10(7-9)13-17-5-6-18-13/h3-4,7,13H,2,5-6,8,14H2,1H3 |
| InChIKey | UNKKVVGTRJNBKG-UHFFFAOYSA-N |
| XLogP | 1.26 |
| TPSA | 80.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.28 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|