C14H10ClFN4O2 — CID 164594263
methyl 6-(3-amino-6-chloro-2-fluorophenyl)imidazo[1,5-a]pyrazine-1-carboxylate (PubChem CID 164594263) has the molecular formula C14H10ClFN4O2 and a molecular weight of 320.71 g/mol. Its IUPAC name is methyl 6-(3-amino-6-chloro-2-fluorophenyl)imidazo[1,5-a]pyrazine-1-carboxylate.
| Compound Name | methyl 6-(3-amino-6-chloro-2-fluorophenyl)imidazo[1,5-a]pyrazine-1-carboxylate |
|---|---|
| PubChem CID | 164594263 |
| Molecular Formula | C14H10ClFN4O2 |
| Molecular Weight | 320.71 g/mol |
| Exact Mass | 320.05 |
| IUPAC Name | methyl 6-(3-amino-6-chloro-2-fluorophenyl)imidazo[1,5-a]pyrazine-1-carboxylate |
| SMILES | COC(=O)c1ncn2cc(-c3c(Cl)ccc(N)c3F)ncc12 |
| InChI | InChI=1S/C14H10ClFN4O2/c1-22-14(21)13-10-4-18-9(5-20(10)6-19-13)11-7(15)2-3-8(17)12(11)16/h2-6H,17H2,1H3 |
| InChIKey | YCYUPMGTFINUIO-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 82.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.71 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|