C12H7F2IN4 — CID 164594670
2,4-difluoro-3-(1-iodoimidazo[1,5-a]pyrazin-6-yl)aniline (PubChem CID 164594670) has the molecular formula C12H7F2IN4 and a molecular weight of 372.12 g/mol. Its IUPAC name is 2,4-difluoro-3-(1-iodoimidazo[1,5-a]pyrazin-6-yl)aniline.
| Compound Name | 2,4-difluoro-3-(1-iodoimidazo[1,5-a]pyrazin-6-yl)aniline |
|---|---|
| PubChem CID | 164594670 |
| Molecular Formula | C12H7F2IN4 |
| Molecular Weight | 372.12 g/mol |
| Exact Mass | 371.97 |
| IUPAC Name | 2,4-difluoro-3-(1-iodoimidazo[1,5-a]pyrazin-6-yl)aniline |
| SMILES | Nc1ccc(F)c(-c2cn3cnc(I)c3cn2)c1F |
| InChI | InChI=1S/C12H7F2IN4/c13-6-1-2-7(16)11(14)10(6)8-4-19-5-18-12(15)9(19)3-17-8/h1-5H,16H2 |
| InChIKey | PTYNPKJONWZVCO-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 56.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.12 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|