C14H9Cl2IN4 — CID 159050239
6-chloroimidazo[1,5-a]pyridine;6-chloro-1-iodoimidazo[1,5-a]pyridine (PubChem CID 159050239) has the molecular formula C14H9Cl2IN4 and a molecular weight of 431.06 g/mol. Its IUPAC name is 6-chloroimidazo[1,5-a]pyridine;6-chloro-1-iodoimidazo[1,5-a]pyridine.
| Compound Name | 6-chloroimidazo[1,5-a]pyridine;6-chloro-1-iodoimidazo[1,5-a]pyridine |
|---|---|
| PubChem CID | 159050239 |
| Molecular Formula | C14H9Cl2IN4 |
| Molecular Weight | 431.06 g/mol |
| Exact Mass | 429.92 |
| IUPAC Name | 6-chloroimidazo[1,5-a]pyridine;6-chloro-1-iodoimidazo[1,5-a]pyridine |
| SMILES | Clc1ccc2c(I)ncn2c1.Clc1ccc2cncn2c1 |
| InChI | InChI=1S/C7H4ClIN2.C7H5ClN2/c8-5-1-2-6-7(9)10-4-11(6)3-5;8-6-1-2-7-3-9-5-10(7)4-6/h1-4H;1-5H |
| InChIKey | JXECKYMAIGSTSU-UHFFFAOYSA-N |
| XLogP | 4.58 |
| TPSA | 34.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.06 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|