C19H16F2N4Sn — CID 164594325
3-[1-[(2E,7Z)-5,6-dihydro-4H-1λ2-stannocin-2-yl]imidazo[1,5-a]pyrazin-6-yl]-2,4-difluoroaniline (PubChem CID 164594325) has the molecular formula C19H16F2N4Sn and a molecular weight of 457.07 g/mol. Its IUPAC name is 3-[1-[(2E,7Z)-5,6-dihydro-4H-1λ2-stannocin-2-yl]imidazo[1,5-a]pyrazin-6-yl]-2,4-difluoroaniline.
| Compound Name | 3-[1-[(2E,7Z)-5,6-dihydro-4H-1λ2-stannocin-2-yl]imidazo[1,5-a]pyrazin-6-yl]-2,4-difluoroaniline |
|---|---|
| PubChem CID | 164594325 |
| Molecular Formula | C19H16F2N4Sn |
| Molecular Weight | 457.07 g/mol |
| Exact Mass | 458.04 |
| IUPAC Name | 3-[1-[(2E,7Z)-5,6-dihydro-4H-1λ2-stannocin-2-yl]imidazo[1,5-a]pyrazin-6-yl]-2,4-difluoroaniline |
| SMILES | Nc1ccc(F)c(-c2cn3cnc(/C4=C/CCC/C=C\[Sn]4)c3cn2)c1F |
| InChI | InChI=1S/C19H16F2N4.Sn/c1-2-3-4-5-6-7-15-17-10-23-16(11-25(17)12-24-15)18-13(20)8-9-14(22)19(18)21;/h1-2,6,8-12H,3-5,22H2; |
| InChIKey | LMJVWUGAISWJRQ-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 56.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.07 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|