C22H24ClN5O2 — CID 90490576
1-(3-chlorophenyl)-3-[[4-oxo-3-(2-pyrrolidin-1-ylethyl)phthalazin-1-yl]methyl]urea (PubChem CID 90490576) has the molecular formula C22H24ClN5O2 and a molecular weight of 425.92 g/mol. Its IUPAC name is 1-(3-chlorophenyl)-3-[[4-oxo-3-(2-pyrrolidin-1-ylethyl)phthalazin-1-yl]methyl]urea.
| Compound Name | 1-(3-chlorophenyl)-3-[[4-oxo-3-(2-pyrrolidin-1-ylethyl)phthalazin-1-yl]methyl]urea |
|---|---|
| PubChem CID | 90490576 |
| Molecular Formula | C22H24ClN5O2 |
| Molecular Weight | 425.92 g/mol |
| Exact Mass | 425.16 |
| IUPAC Name | 1-(3-chlorophenyl)-3-[[4-oxo-3-(2-pyrrolidin-1-ylethyl)phthalazin-1-yl]methyl]urea |
| SMILES | O=C(NCc1nn(CCN2CCCC2)c(=O)c2ccccc12)Nc1cccc(Cl)c1 |
| InChI | InChI=1S/C22H24ClN5O2/c23-16-6-5-7-17(14-16)25-22(30)24-15-20-18-8-1-2-9-19(18)21(29)28(26-20)13-12-27-10-3-4-11-27/h1-2,5-9,14H,3-4,10-13,15H2,(H2,24,25,30) |
| InChIKey | JOZJOPJJBVRBQP-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 79.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.92 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |