C29H30N4O2 — CID 90490531
N-[[4-oxo-3-(2-pyrrolidin-1-ylethyl)phthalazin-1-yl]methyl]-2-(4-phenylphenyl)acetamide (PubChem CID 90490531) has the molecular formula C29H30N4O2 and a molecular weight of 466.59 g/mol. Its IUPAC name is N-[[4-oxo-3-(2-pyrrolidin-1-ylethyl)phthalazin-1-yl]methyl]-2-(4-phenylphenyl)acetamide.
| Compound Name | N-[[4-oxo-3-(2-pyrrolidin-1-ylethyl)phthalazin-1-yl]methyl]-2-(4-phenylphenyl)acetamide |
|---|---|
| PubChem CID | 90490531 |
| Molecular Formula | C29H30N4O2 |
| Molecular Weight | 466.59 g/mol |
| Exact Mass | 466.24 |
| IUPAC Name | N-[[4-oxo-3-(2-pyrrolidin-1-ylethyl)phthalazin-1-yl]methyl]-2-(4-phenylphenyl)acetamide |
| SMILES | O=C(Cc1ccc(-c2ccccc2)cc1)NCc1nn(CCN2CCCC2)c(=O)c2ccccc12 |
| InChI | InChI=1S/C29H30N4O2/c34-28(20-22-12-14-24(15-13-22)23-8-2-1-3-9-23)30-21-27-25-10-4-5-11-26(25)29(35)33(31-27)19-18-32-16-6-7-17-32/h1-5,8-15H,6-7,16-21H2,(H,30,34) |
| InChIKey | GEFZFVOUQBDTSL-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 67.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.59 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |