C22H31N5O2 — CID 90490574
1-cyclohexyl-3-[[4-oxo-3-(2-pyrrolidin-1-ylethyl)phthalazin-1-yl]methyl]urea (PubChem CID 90490574) has the molecular formula C22H31N5O2 and a molecular weight of 397.52 g/mol. Its IUPAC name is 1-cyclohexyl-3-[[4-oxo-3-(2-pyrrolidin-1-ylethyl)phthalazin-1-yl]methyl]urea.
| Compound Name | 1-cyclohexyl-3-[[4-oxo-3-(2-pyrrolidin-1-ylethyl)phthalazin-1-yl]methyl]urea |
|---|---|
| PubChem CID | 90490574 |
| Molecular Formula | C22H31N5O2 |
| Molecular Weight | 397.52 g/mol |
| Exact Mass | 397.25 |
| IUPAC Name | 1-cyclohexyl-3-[[4-oxo-3-(2-pyrrolidin-1-ylethyl)phthalazin-1-yl]methyl]urea |
| SMILES | O=C(NCc1nn(CCN2CCCC2)c(=O)c2ccccc12)NC1CCCCC1 |
| InChI | InChI=1S/C22H31N5O2/c28-21-19-11-5-4-10-18(19)20(25-27(21)15-14-26-12-6-7-13-26)16-23-22(29)24-17-8-2-1-3-9-17/h4-5,10-11,17H,1-3,6-9,12-16H2,(H2,23,24,29) |
| InChIKey | PRAMLQXDMJLVTM-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 79.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.52 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |