C23H27N5O2 — CID 121049429
1-cycloheptyl-3-[[4-oxo-3-(pyridin-3-ylmethyl)phthalazin-1-yl]methyl]urea (PubChem CID 121049429) has the molecular formula C23H27N5O2 and a molecular weight of 405.50 g/mol. Its IUPAC name is 1-cycloheptyl-3-[[4-oxo-3-(pyridin-3-ylmethyl)phthalazin-1-yl]methyl]urea.
| Compound Name | 1-cycloheptyl-3-[[4-oxo-3-(pyridin-3-ylmethyl)phthalazin-1-yl]methyl]urea |
|---|---|
| PubChem CID | 121049429 |
| Molecular Formula | C23H27N5O2 |
| Molecular Weight | 405.50 g/mol |
| Exact Mass | 405.22 |
| IUPAC Name | 1-cycloheptyl-3-[[4-oxo-3-(pyridin-3-ylmethyl)phthalazin-1-yl]methyl]urea |
| SMILES | O=C(NCc1nn(Cc2cccnc2)c(=O)c2ccccc12)NC1CCCCCC1 |
| InChI | InChI=1S/C23H27N5O2/c29-22-20-12-6-5-11-19(20)21(27-28(22)16-17-8-7-13-24-14-17)15-25-23(30)26-18-9-3-1-2-4-10-18/h5-8,11-14,18H,1-4,9-10,15-16H2,(H2,25,26,30) |
| InChIKey | JVROPNLTOBMOOS-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 88.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.50 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |